What is the AMMONIUM ISOVALERATE?

AMMONIUM ISOVALERATE is , while it's Molecular Formula is C5H13NO2. Used in Food Industry: Ammonium isovalerate is used as a flavoring agent for enhancing the taste of butter, nut, and cheese-flavored products. Its unique aroma helps to create a more authentic and appealing flavor profile in these food items.

What is the CAS number for AMMONIUM ISOVALERATE?

The CAS number of AMMONIUM ISOVALERATE is 7563-33-9.

What is AMMONIUM ISOVALERATE (7563-33-9) used for?

Ammonium isovalerate is a chemical compound with a sharp, cheesy, yet somewhat sweet aroma. It is commonly used as a flavoring agent in various food products.InChI:InChI=1/C5H10O2.H3N/c1-4(2)3-5(6)7;/h4H,3H2,1-2H3,(H,6,7);1H3