5-IODO-2-METHYLANILINE

5-IODO-2-METHYLANILINE Good Manufacturer supply High Quality 83863-33-6 We supply high quality 5-IODO-2-METHYLANILINE (CAS 83863-33-6), in stock, factory directly supply to clients, lower prices, more competitiveness.

What is the 5-IODO-2-METHYLANILINE ?

5-IODO-2-METHYLANILINE is WHITE TO TAN POWDER, CRYSTALS Crystalline Powder and/or Chunks, while it's Molecular Formula is C7H8IN. Used in Research and Development:
5-IODO-2-METHYLANILINE is used as a chemical intermediate for the synthesis of various compounds in the field of organic chemistry. Its unique structure with an iodine atom and a methyl group allows it to participate in a range of chemical reactions, making it a valuable component in the development of new molecules and materials.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-IODO-2-METHYLANILINE is used as a building block for the synthesis of potential drug candidates. Its presence in the molecular structure can influence the pharmacological properties of the final product, such as solubility, stability, and bioavailability, which are crucial for the drug's effectiveness and safety.
Used in Material Science:
5-IODO-2-METHYLANILINE is employed as a component in the synthesis of advanced materials, such as polymers and composites, with specific properties tailored for various applications. The iodine and methyl groups in its structure can contribute to the material's characteristics, such as electrical conductivity, mechanical strength, or thermal stability.
Used in Dye and Pigment Industry:
5-IODO-2-METHYLANILINE is used as a precursor in the production of dyes and pigments, where its chemical structure can influence the color, stability, and other properties of the final product. This makes it an important compound in the development of new colorants for various industries, such as textiles, plastics, and printing.
Used in Analytical Chemistry:
In analytical chemistry, 5-IODO-2-METHYLANILINE can be used as a reagent or a reference compound in various analytical techniques, such as spectroscopy, chromatography, or electrochemistry. Its unique chemical properties can help in the identification, quantification, or separation of other compounds in complex mixtures.

What is the CAS number for 5-IODO-2-METHYLANILINE ?

The CAS number of 5-IODO-2-METHYLANILINE is 83863-33-6.

More information of 5-IODO-2-METHYLANILINE 83863-33-6 are:

What is 5-IODO-2-METHYLANILINE (83863-33-6) used for?

5-IODO-2-METHYLANILINE, with the chemical formula C7H8INO, is an organic compound belonging to the family of Anilines and its derivatives. It is characterized by the presence of iodine (I), carbon (C), hydrogen (H), and nitrogen (N) elements. The base structure of 5-IODO-2-METHYLANILINE is Aniline, a primary amine featuring a benzene ring connected to an amino group. The unique feature of 5-IODO-2-METHYLANILINE is the substitution of an iodine atom and a methyl group at positions 5 and 2, respectively. 5-IODO-2-METHYLANILINE is primarily utilized in research and development, particularly in various synthesis processes. Its physical and chemical properties, as well as the necessary handling and safety measures, should be consulted in an official and comprehensive chemical database.

InChI:InChI=1/C7H8IN/c1-5-2-3-6(8)4-7(5)9/h2-4H,9H2,1H3

Articles related to 5-IODO-2-METHYLANILINE:

How to get the best price on 5-IODO-2-METHYLANILINE?

Anhui Hefei Aiersen Chemicals Co,.Ltd is a quality supplier and manufacturer of 5-IODO-2-METHYLANILINE . You can buy high quality, low price 5-IODO-2-METHYLANILINE 83863-33-6 here. Contact us.